![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 41 Formation & evolution of the Ververonda lagoon.pdf | 01-Apr-2015 13:27 | 9.0M | |
| 28 Elaboration of GIS based multidisciplinary data for microzoning studies.pdf | 01-Apr-2015 13:23 | 8.2M | |
| 16 Hydrological investigations of Mantineia.pdf | 01-Apr-2015 13:23 | 8.1M | |
| 64 Synergy of tectonic geomorphology, applied geophysics and remote sensing techniques.pdf | 01-Apr-2015 13:27 | 7.7M | |
| 37 Resistivity and VLF measurements for spring mechanism determination at NE Chios Isl.pdf | 01-Apr-2015 13:27 | 6.6M | |
| 26 Low-strain techniques used for microzoning studies.pdf | 01-Apr-2015 13:23 | 6.4M | |
| 13 The pre-Pleistocene structure investigation of Manteinia.pdf | 01-Apr-2015 13:23 | 6.2M | |
| 15 Morfotectonic evolution of Saga-Nestani.pdf | 01-Apr-2015 13:23 | 6.2M | |
| 14 Palaiogeographical evolution of north Tripolis plateau.pdf | 01-Apr-2015 13:23 | 6.1M | |
| 32 Investigation of hydrogeological factors.pdf | 01-Apr-2015 13:23 | 5.9M | |
| 18 A comparative study for structural bedrock delineation.pdf | 01-Apr-2015 13:23 | 5.9M | |
| 12 Geomorphological structure investigation of Poliani.pdf | 01-Apr-2015 13:23 | 5.6M | |
| 58 Temporal evolution and assessment of groundwater quality - Pinios.pdf | 01-Apr-2015 13:27 | 5.2M | |
| 19 Detailed shallow structure seismic refraction investigation.pdf | 01-Apr-2015 13:23 | 5.1M | |
| 38 Contribution of geophysical approach.pdf | 01-Apr-2015 13:27 | 5.1M | |
| 20 Contribution of modern seismic methods.pdf | 01-Apr-2015 13:23 | 4.7M | |
| 17 Geoelectrical survey for Tatoi.pdf | 01-Apr-2015 13:23 | 4.7M | |
| 31 SN enhancement by radon transformation.pdf | 01-Apr-2015 13:23 | 4.4M | |
| 06 Combined geophysical methods.pdf | 10-Feb-2015 18:08 | 4.2M | |
| 59 Groundwater flow regime - Pinios.pdf | 01-Apr-2015 13:27 | 3.7M | |
| 55 ERT and VLF measurements - Trapezous.pdf | 01-Apr-2015 13:27 | 3.6M | |
| 21 Downhole seismic logging.pdf | 01-Apr-2015 13:23 | 3.3M | |
| 39 Pre-pleistocene palaeo-relief investigation of the Levidi.pdf | 01-Apr-2015 13:27 | 3.1M | |
| 22 The subsurface tectonic structure of the Farsala.pdf | 01-Apr-2015 13:23 | 2.9M | |
| 05 AUTO-SEISMO-GEOTECH.Seismicity.pdf | 10-Feb-2015 18:07 | 2.7M | |
| 09 Outlining complicated subsurface geological conditions.pdf | 01-Apr-2015 13:23 | 2.7M | |
| 03 Combined geophysical investigations.pdf | 10-Feb-2015 18:07 | 2.7M | |
| 10 Combined geophysical methods for detailed microzoning studies.pdf | 01-Apr-2015 13:23 | 2.6M | |
| 04 AUTO-SEISMO-GEOTECH.Geophysical.pdf | 10-Feb-2015 18:07 | 2.5M | |
| 57 A geophysical insight - Oiti Kallidromo.pdf | 01-Apr-2015 13:27 | 2.5M | |
| 44 Quantification of River Valley.pdf | 01-Apr-2015 13:27 | 2.2M | |
| 40 Elaboration of GIS based Multidisciplinary data for microzoning studies.pdf | 01-Apr-2015 13:27 | 2.2M | |
| 34 A contribution to Environmental Research �f the Korissia coastal wetland.pdf | 01-Apr-2015 13:23 | 2.2M | |
| 56 Application of geoelectrical techniques - Kakovatos.pdf | 01-Apr-2015 13:27 | 2.1M | |
| 02 Geoelectrical sounding.pdf | 10-Feb-2015 18:07 | 2.0M | |
| 07 Dynamic elastic properties evaluation.pdf | 10-Feb-2015 18:07 | 1.9M | |
| 46 Recognition of strike-slip faulting.pdf | 01-Apr-2015 13:27 | 1.9M | |
| 43 Geophysical investigations for aquifer detection.pdf | 01-Apr-2015 13:27 | 1.7M | |
| 33 Tectonic Structure �f Central-Western Attica.pdf | 01-Apr-2015 13:23 | 1.6M | |
| 11 Combined geophysical methods for cavity detection.pdf | 01-Apr-2015 13:23 | 1.3M | |
| 42 Geophysical research foe geological structure.pdf | 01-Apr-2015 13:27 | 1.3M | |
| 30 Use of surface waves for geotechnical characterization.pdf | 01-Apr-2015 13:23 | 1.3M | |
| 51 High resolution geophysical techniques - Kyparissiakos.pdf | 01-Apr-2015 13:27 | 1.2M | |
| 54 Seasonal variation of water discharge - Pinios.pdf | 01-Apr-2015 13:27 | 1.2M | |
| 53 Chemical quality of groundwaters - Pinios.pdf | 01-Apr-2015 13:27 | 1.1M | |
| 52 Combined geophysical investigations.pdf | 01-Apr-2015 13:27 | 1.1M | |
| 45 Adumbration of Amvrakia�s spring water pathways.pdf | 01-Apr-2015 13:27 | 1.1M | |
| 50 Identification of buried active structures.pdf | 01-Apr-2015 13:27 | 1.1M | |
| 29 New evidence for the seismotectonic environment.pdf | 01-Apr-2015 13:23 | 926K | |
| 48 Quantification of human impact.pdf | 01-Apr-2015 13:27 | 919K | |
| 27 Installation and preliminary results from a small aperture seismic array.pdf | 01-Apr-2015 13:23 | 807K | |
| 35 Geomorphologic and hydrologic environment of Korissia lagoon.pdf | 01-Apr-2015 13:23 | 796K | |
| 25 A GIS based application for seismic risk.pdf | 01-Apr-2015 13:23 | 538K | |
| 49 An investigation of the impact of the climate change.pdf | 01-Apr-2015 13:27 | 410K | |
|
|---|